C21H31ClFN3O4S — CID 10600659
(2S,3S)-3-(2-chloro-4-fluorophenyl)sulfanyl-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide (PubChem CID 10600659) has the molecular formula C21H31ClFN3O4S and a molecular weight of 476.01 g/mol. Its IUPAC name is (2S,3S)-3-(2-chloro-4-fluorophenyl)sulfanyl-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide.
| Compound Name | (2S,3S)-3-(2-chloro-4-fluorophenyl)sulfanyl-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 10600659 |
| Molecular Formula | C21H31ClFN3O4S |
| Molecular Weight | 476.01 g/mol |
| Exact Mass | 475.17 |
| IUPAC Name | (2S,3S)-3-(2-chloro-4-fluorophenyl)sulfanyl-N-[(2S)-3,3-dimethyl-1-(methylamino)-1-oxobutan-2-yl]-N'-hydroxy-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)[C@@H](NC(=O)[C@H](CC(C)C)[C@H](Sc1ccc(F)cc1Cl)C(=O)NO)C(C)(C)C |
| InChI | InChI=1S/C21H31ClFN3O4S/c1-11(2)9-13(18(27)25-17(20(29)24-6)21(3,4)5)16(19(28)26-30)31-15-8-7-12(23)10-14(15)22/h7-8,10-11,13,16-17,30H,9H2,1-6H3,(H,24,29)(H,25,27)(H,26,28)/t13-,16+,17-/m1/s1 |
| InChIKey | LWBGYDKYPZYFIZ-XOKHGSTOSA-N |
| XLogP | 3.38 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.01 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|