C26H37N3O4 — CID 142075052
N'-heptan-4-yloxy-N-[1-(methylamino)-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)butanediamide (PubChem CID 142075052) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is N'-heptan-4-yloxy-N-[1-(methylamino)-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)butanediamide.
| Compound Name | N'-heptan-4-yloxy-N-[1-(methylamino)-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)butanediamide |
|---|---|
| PubChem CID | 142075052 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | N'-heptan-4-yloxy-N-[1-(methylamino)-1-oxopropan-2-yl]-2-(naphthalen-2-ylmethyl)butanediamide |
| SMILES | CCCC(CCC)ONC(=O)CC(Cc1ccc2ccccc2c1)C(=O)NC(C)C(=O)NC |
| InChI | InChI=1S/C26H37N3O4/c1-5-9-23(10-6-2)33-29-24(30)17-22(26(32)28-18(3)25(31)27-4)16-19-13-14-20-11-7-8-12-21(20)15-19/h7-8,11-15,18,22-23H,5-6,9-10,16-17H2,1-4H3,(H,27,31)(H,28,32)(H,29,30) |
| InChIKey | VSYQDFWQUHZOOS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|