C26H27BrNO6P — CID 70147295
2-[(4-bromophenyl)methyl]-3-[hydroxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoic acid (PubChem CID 70147295) has the molecular formula C26H27BrNO6P and a molecular weight of 560.38 g/mol. Its IUPAC name is 2-[(4-bromophenyl)methyl]-3-[hydroxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoic acid.
| Compound Name | 2-[(4-bromophenyl)methyl]-3-[hydroxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoic acid |
|---|---|
| PubChem CID | 70147295 |
| Molecular Formula | C26H27BrNO6P |
| Molecular Weight | 560.38 g/mol |
| Exact Mass | 559.08 |
| IUPAC Name | 2-[(4-bromophenyl)methyl]-3-[hydroxy-[2-phenyl-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]propanoic acid |
| SMILES | O=C(NC(Cc1ccccc1)P(=O)(O)CC(Cc1ccc(Br)cc1)C(=O)O)OCc1ccccc1 |
| InChI | InChI=1S/C26H27BrNO6P/c27-23-13-11-20(12-14-23)15-22(25(29)30)18-35(32,33)24(16-19-7-3-1-4-8-19)28-26(31)34-17-21-9-5-2-6-10-21/h1-14,22,24H,15-18H2,(H,28,31)(H,29,30)(H,32,33) |
| InChIKey | YQFSYGCALZJLRR-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.38 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|