C26H28NO6P — CID 10719553
2-[[hydroxy-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid (PubChem CID 10719553) has the molecular formula C26H28NO6P and a molecular weight of 481.49 g/mol. Its IUPAC name is 2-[[hydroxy-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid.
| Compound Name | 2-[[hydroxy-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid |
|---|---|
| PubChem CID | 10719553 |
| Molecular Formula | C26H28NO6P |
| Molecular Weight | 481.49 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | 2-[[hydroxy-[(1R)-1-(phenylmethoxycarbonylamino)ethyl]phosphoryl]methyl]-3-(4-phenylphenyl)propanoic acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)P(=O)(O)CC(Cc1ccc(-c2ccccc2)cc1)C(=O)O |
| InChI | InChI=1S/C26H28NO6P/c1-19(27-26(30)33-17-21-8-4-2-5-9-21)34(31,32)18-24(25(28)29)16-20-12-14-23(15-13-20)22-10-6-3-7-11-22/h2-15,19,24H,16-18H2,1H3,(H,27,30)(H,28,29)(H,31,32)/t19-,24?/m1/s1 |
| InChIKey | LZAQAWWDUTXZGB-PHSANKKPSA-N |
| XLogP | 5.14 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.49 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|