C23H23NO6P2 — CID 175556052
[(1R)-1-(phenylmethoxycarbonylamino)ethyl]-[(5-phenyl-2-phosphorosooxyphenyl)methyl]phosphinic acid (PubChem CID 175556052) has the molecular formula C23H23NO6P2 and a molecular weight of 471.39 g/mol. Its IUPAC name is [(1R)-1-(phenylmethoxycarbonylamino)ethyl]-[(5-phenyl-2-phosphorosooxyphenyl)methyl]phosphinic acid.
| Compound Name | [(1R)-1-(phenylmethoxycarbonylamino)ethyl]-[(5-phenyl-2-phosphorosooxyphenyl)methyl]phosphinic acid |
|---|---|
| PubChem CID | 175556052 |
| Molecular Formula | C23H23NO6P2 |
| Molecular Weight | 471.39 g/mol |
| Exact Mass | 471.10 |
| IUPAC Name | [(1R)-1-(phenylmethoxycarbonylamino)ethyl]-[(5-phenyl-2-phosphorosooxyphenyl)methyl]phosphinic acid |
| SMILES | C[C@H](NC(=O)OCc1ccccc1)P(=O)(O)Cc1cc(-c2ccccc2)ccc1OP=O |
| InChI | InChI=1S/C23H23NO6P2/c1-17(24-23(25)29-15-18-8-4-2-5-9-18)32(27,28)16-21-14-20(12-13-22(21)30-31-26)19-10-6-3-7-11-19/h2-14,17H,15-16H2,1H3,(H,24,25)(H,27,28)/t17-/m1/s1 |
| InChIKey | TXRGKLPQHBLWKV-QGZVFWFLSA-N |
| XLogP | 5.98 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.39 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|