C30H32NO8P — CID 11541403
2-benzyl-3-[[1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxyphosphoryl]propanoic acid (PubChem CID 11541403) has the molecular formula C30H32NO8P and a molecular weight of 565.56 g/mol. Its IUPAC name is 2-benzyl-3-[[1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxyphosphoryl]propanoic acid.
| Compound Name | 2-benzyl-3-[[1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxyphosphoryl]propanoic acid |
|---|---|
| PubChem CID | 11541403 |
| Molecular Formula | C30H32NO8P |
| Molecular Weight | 565.56 g/mol |
| Exact Mass | 565.19 |
| IUPAC Name | 2-benzyl-3-[[1-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methoxy-4-oxobutyl]-hydroxyphosphoryl]propanoic acid |
| SMILES | COC(=O)CCC(NC(=O)OCC1c2ccccc2-c2ccccc21)P(=O)(O)CC(Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H32NO8P/c1-38-28(32)16-15-27(40(36,37)19-21(29(33)34)17-20-9-3-2-4-10-20)31-30(35)39-18-26-24-13-7-5-11-22(24)23-12-6-8-14-25(23)26/h2-14,21,26-27H,15-19H2,1H3,(H,31,35)(H,33,34)(H,36,37) |
| InChIKey | CENVOTISRKMDGE-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 139.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.56 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|