C22H31N2O3P — CID 21364418
[2-(2-aminoacetyl)-5-phenylpentyl]-[1-(methylamino)-2-phenylethyl]phosphinic acid (PubChem CID 21364418) has the molecular formula C22H31N2O3P and a molecular weight of 402.48 g/mol. Its IUPAC name is [2-(2-aminoacetyl)-5-phenylpentyl]-[1-(methylamino)-2-phenylethyl]phosphinic acid.
| Compound Name | [2-(2-aminoacetyl)-5-phenylpentyl]-[1-(methylamino)-2-phenylethyl]phosphinic acid |
|---|---|
| PubChem CID | 21364418 |
| Molecular Formula | C22H31N2O3P |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | [2-(2-aminoacetyl)-5-phenylpentyl]-[1-(methylamino)-2-phenylethyl]phosphinic acid |
| SMILES | CNC(Cc1ccccc1)P(=O)(O)CC(CCCc1ccccc1)C(=O)CN |
| InChI | InChI=1S/C22H31N2O3P/c1-24-22(15-19-11-6-3-7-12-19)28(26,27)17-20(21(25)16-23)14-8-13-18-9-4-2-5-10-18/h2-7,9-12,20,22,24H,8,13-17,23H2,1H3,(H,26,27) |
| InChIKey | LWGFQBUYZVNDQK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|