C21H28NO4P — CID 118720636
2-[[(1-amino-3-phenylpropyl)-hydroxyphosphoryl]methyl]-3-(3,5-dimethylphenyl)propanoic acid (PubChem CID 118720636) has the molecular formula C21H28NO4P and a molecular weight of 389.43 g/mol. Its IUPAC name is 2-[[(1-amino-3-phenylpropyl)-hydroxyphosphoryl]methyl]-3-(3,5-dimethylphenyl)propanoic acid.
| Compound Name | 2-[[(1-amino-3-phenylpropyl)-hydroxyphosphoryl]methyl]-3-(3,5-dimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 118720636 |
| Molecular Formula | C21H28NO4P |
| Molecular Weight | 389.43 g/mol |
| Exact Mass | 389.18 |
| IUPAC Name | 2-[[(1-amino-3-phenylpropyl)-hydroxyphosphoryl]methyl]-3-(3,5-dimethylphenyl)propanoic acid |
| SMILES | Cc1cc(C)cc(CC(CP(=O)(O)C(N)CCc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C21H28NO4P/c1-15-10-16(2)12-18(11-15)13-19(21(23)24)14-27(25,26)20(22)9-8-17-6-4-3-5-7-17/h3-7,10-12,19-20H,8-9,13-14,22H2,1-2H3,(H,23,24)(H,25,26) |
| InChIKey | XTCAOJQUSFRSJC-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.43 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|