C17H22NO3P — CID 46886382
(1-amino-3-phenylpropyl)-(2,5-dimethylphenoxy)phosphinic acid (PubChem CID 46886382) has the molecular formula C17H22NO3P and a molecular weight of 319.34 g/mol. Its IUPAC name is (1-amino-3-phenylpropyl)-(2,5-dimethylphenoxy)phosphinic acid.
| Compound Name | (1-amino-3-phenylpropyl)-(2,5-dimethylphenoxy)phosphinic acid |
|---|---|
| PubChem CID | 46886382 |
| Molecular Formula | C17H22NO3P |
| Molecular Weight | 319.34 g/mol |
| Exact Mass | 319.13 |
| IUPAC Name | (1-amino-3-phenylpropyl)-(2,5-dimethylphenoxy)phosphinic acid |
| SMILES | Cc1ccc(C)c(OP(=O)(O)C(N)CCc2ccccc2)c1 |
| InChI | InChI=1S/C17H22NO3P/c1-13-8-9-14(2)16(12-13)21-22(19,20)17(18)11-10-15-6-4-3-5-7-15/h3-9,12,17H,10-11,18H2,1-2H3,(H,19,20) |
| InChIKey | WRZWRAQKUFSSQO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.34 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|