C19H26NO3P — CID 46886386
(1-amino-3-phenylpropyl)-(4-tert-butylphenoxy)phosphinic acid (PubChem CID 46886386) has the molecular formula C19H26NO3P and a molecular weight of 347.40 g/mol. Its IUPAC name is (1-amino-3-phenylpropyl)-(4-tert-butylphenoxy)phosphinic acid.
| Compound Name | (1-amino-3-phenylpropyl)-(4-tert-butylphenoxy)phosphinic acid |
|---|---|
| PubChem CID | 46886386 |
| Molecular Formula | C19H26NO3P |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | (1-amino-3-phenylpropyl)-(4-tert-butylphenoxy)phosphinic acid |
| SMILES | CC(C)(C)c1ccc(OP(=O)(O)C(N)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H26NO3P/c1-19(2,3)16-10-12-17(13-11-16)23-24(21,22)18(20)14-9-15-7-5-4-6-8-15/h4-8,10-13,18H,9,14,20H2,1-3H3,(H,21,22) |
| InChIKey | CJMCRRZLZPAWLQ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|