C20H28NaO4P — CID 174748805
sodium;bis(4-tert-butylphenyl) hydrogen phosphate;hydride (PubChem CID 174748805) has the molecular formula C20H28NaO4P and a molecular weight of 386.40 g/mol. Its IUPAC name is sodium;bis(4-tert-butylphenyl) hydrogen phosphate;hydride.
| Compound Name | sodium;bis(4-tert-butylphenyl) hydrogen phosphate;hydride |
|---|---|
| PubChem CID | 174748805 |
| Molecular Formula | C20H28NaO4P |
| Molecular Weight | 386.40 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | sodium;bis(4-tert-butylphenyl) hydrogen phosphate;hydride |
| SMILES | CC(C)(C)c1ccc(OP(=O)(O)Oc2ccc(C(C)(C)C)cc2)cc1.[H-].[Na+] |
| InChI | InChI=1S/C20H27O4P.Na.H/c1-19(2,3)15-7-11-17(12-8-15)23-25(21,22)24-18-13-9-16(10-14-18)20(4,5)6;;/h7-14H,1-6H3,(H,21,22);;/q;+1;-1 |
| InChIKey | IFMZPBXXZWKPFV-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.40 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|