C11H16O3P- — CID 2313159
(4-tert-butylphenoxy)-methylphosphinate (PubChem CID 2313159) has the molecular formula C11H16O3P- and a molecular weight of 227.22 g/mol. Its IUPAC name is (4-tert-butylphenoxy)-methylphosphinate.
| Compound Name | (4-tert-butylphenoxy)-methylphosphinate |
|---|---|
| PubChem CID | 2313159 |
| Molecular Formula | C11H16O3P- |
| Molecular Weight | 227.22 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | (4-tert-butylphenoxy)-methylphosphinate |
| SMILES | CC(C)(C)c1ccc(OP(C)(=O)[O-])cc1 |
| InChI | InChI=1S/C11H17O3P/c1-11(2,3)9-5-7-10(8-6-9)14-15(4,12)13/h5-8H,1-4H3,(H,12,13)/p-1 |
| InChIKey | HPGUBDXCXYBTGF-UHFFFAOYSA-M |
| XLogP | 2.55 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.22 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|