C22H31O3PS — CID 11327235
bis(4-tert-butylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane (PubChem CID 11327235) has the molecular formula C22H31O3PS and a molecular weight of 406.53 g/mol. Its IUPAC name is bis(4-tert-butylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | bis(4-tert-butylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 11327235 |
| Molecular Formula | C22H31O3PS |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | bis(4-tert-butylphenoxy)-ethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(Oc1ccc(C(C)(C)C)cc1)Oc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C22H31O3PS/c1-8-23-26(27,24-19-13-9-17(10-14-19)21(2,3)4)25-20-15-11-18(12-16-20)22(5,6)7/h9-16H,8H2,1-7H3 |
| InChIKey | XWMLSOOGAQETSP-UHFFFAOYSA-N |
| XLogP | 7.00 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 7.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|