C21H32NO4P — CID 3020874
azanium (4-tert-butylphenyl) [4-(2-methylbutan-2-yl)phenyl] phosphate (PubChem CID 3020874) has the molecular formula C21H32NO4P and a molecular weight of 393.46 g/mol. Its IUPAC name is azanium (4-tert-butylphenyl) [4-(2-methylbutan-2-yl)phenyl] phosphate.
| Compound Name | azanium (4-tert-butylphenyl) [4-(2-methylbutan-2-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 3020874 |
| Molecular Formula | C21H32NO4P |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | azanium (4-tert-butylphenyl) [4-(2-methylbutan-2-yl)phenyl] phosphate |
| SMILES | CCC(C)(C)c1ccc(OP(=O)([O-])Oc2ccc(C(C)(C)C)cc2)cc1.[NH4+] |
| InChI | InChI=1S/C21H29O4P.H3N/c1-7-21(5,6)17-10-14-19(15-11-17)25-26(22,23)24-18-12-8-16(9-13-18)20(2,3)4;/h8-15H,7H2,1-6H3,(H,22,23);1H3 |
| InChIKey | XXQVAIZNXFCTMK-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 95.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|