C20H28O6P2S2 — CID 134111736
[4-(4-diethoxyphosphinothioyloxyphenyl)phenoxy]-diethoxy-sulfanylidene-λ5-phosphane (PubChem CID 134111736) has the molecular formula C20H28O6P2S2 and a molecular weight of 490.52 g/mol. Its IUPAC name is [4-(4-diethoxyphosphinothioyloxyphenyl)phenoxy]-diethoxy-sulfanylidene-λ5-phosphane.
| Compound Name | [4-(4-diethoxyphosphinothioyloxyphenyl)phenoxy]-diethoxy-sulfanylidene-λ5-phosphane |
|---|---|
| PubChem CID | 134111736 |
| Molecular Formula | C20H28O6P2S2 |
| Molecular Weight | 490.52 g/mol |
| Exact Mass | 490.08 |
| IUPAC Name | [4-(4-diethoxyphosphinothioyloxyphenyl)phenoxy]-diethoxy-sulfanylidene-λ5-phosphane |
| SMILES | CCOP(=S)(OCC)Oc1ccc(-c2ccc(OP(=S)(OCC)OCC)cc2)cc1 |
| InChI | InChI=1S/C20H28O6P2S2/c1-5-21-27(29,22-6-2)25-19-13-9-17(10-14-19)18-11-15-20(16-12-18)26-28(30,23-7-3)24-8-4/h9-16H,5-8H2,1-4H3 |
| InChIKey | HVCMJVRAFOQWDP-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.52 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|