About [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate
[(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate (PubChem CID 24841781) has the molecular formula C18H27N2O5PS
and a molecular weight of 414.46 g/mol. Its IUPAC name is [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate.
Molecular Properties
| Compound Name | [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate |
| PubChem CID | 24841781 |
| Molecular Formula | C18H27N2O5PS |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.14 |
| IUPAC Name | [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate |
| SMILES | CCOP(=S)(OCC)Oc1ccc(/C(C)=N\OC(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C18H27N2O5PS/c1-4-22-26(27,23-5-2)25-17-11-9-16(10-12-17)15(3)19-24-18(21)20-13-7-6-8-14-20/h9-12H,4-8,13-14H2,1-3H3/b19-15- |
| InChIKey | BUTLHDDIWVDBKF-CYVLTUHYSA-N |
| XLogP | 4.71 |
| TPSA | 69.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate?
The IUPAC name of [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate (CID 24841781) is [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate.
What is the SMILES notation for [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate?
The canonical SMILES for [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate is CCOP(=S)(OCC)Oc1ccc(/C(C)=N\OC(=O)N2CCCCC2)cc1.
What is the InChIKey of [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate?
The InChIKey is BUTLHDDIWVDBKF-CYVLTUHYSA-N. The full InChI is InChI=1S/C18H27N2O5PS/c1-4-22-26(27,23-5-2)25-17-11-9-16(10-12-17)15(3)19-24-18(21)20-13-7-6-8-14-20/h9-12H,4-8,13-14H2,1-3H3/b19-15-.
What are the key properties of [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate?
[(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate has a molecular weight of 414.46 g/mol, XLogP of 4.71, 8 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-1-(4-diethoxyphosphinothioyloxyphenyl)ethylideneamino] piperidine-1-carboxylate is sourced from PubChem (CID 24841781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).