C28H32N4O6S — CID 155208028
[(E)-[1-[4-[4-[(2E)-2-(methylcarbamoyloxyimino)butanoyl]phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] piperidine-1-carboxylate (PubChem CID 155208028) has the molecular formula C28H32N4O6S and a molecular weight of 552.65 g/mol. Its IUPAC name is [(E)-[1-[4-[4-[(2E)-2-(methylcarbamoyloxyimino)butanoyl]phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] piperidine-1-carboxylate.
| Compound Name | [(E)-[1-[4-[4-[(2E)-2-(methylcarbamoyloxyimino)butanoyl]phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155208028 |
| Molecular Formula | C28H32N4O6S |
| Molecular Weight | 552.65 g/mol |
| Exact Mass | 552.20 |
| IUPAC Name | [(E)-[1-[4-[4-[(2E)-2-(methylcarbamoyloxyimino)butanoyl]phenyl]sulfanylphenyl]-1-oxobutan-2-ylidene]amino] piperidine-1-carboxylate |
| SMILES | CC/C(=N\OC(=O)NC)C(=O)c1ccc(Sc2ccc(C(=O)/C(CC)=N/OC(=O)N3CCCCC3)cc2)cc1 |
| InChI | InChI=1S/C28H32N4O6S/c1-4-23(30-37-27(35)29-3)25(33)19-9-13-21(14-10-19)39-22-15-11-20(12-16-22)26(34)24(5-2)31-38-28(36)32-17-7-6-8-18-32/h9-16H,4-8,17-18H2,1-3H3,(H,29,35)/b30-23+,31-24+ |
| InChIKey | NLRYKTOCMXXZJU-OQXOEEKASA-N |
| XLogP | 5.71 |
| TPSA | 126.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.65 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|