C34H43F3N4O4S — CID 155207914
[(E)-[2-ethyl-1-[4-[4-[(Z)-N-(piperidine-1-carbonyloxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]sulfanylphenyl]hexylidene]amino] piperidine-1-carboxylate (PubChem CID 155207914) has the molecular formula C34H43F3N4O4S and a molecular weight of 660.80 g/mol. Its IUPAC name is [(E)-[2-ethyl-1-[4-[4-[(Z)-N-(piperidine-1-carbonyloxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]sulfanylphenyl]hexylidene]amino] piperidine-1-carboxylate.
| Compound Name | [(E)-[2-ethyl-1-[4-[4-[(Z)-N-(piperidine-1-carbonyloxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]sulfanylphenyl]hexylidene]amino] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 155207914 |
| Molecular Formula | C34H43F3N4O4S |
| Molecular Weight | 660.80 g/mol |
| Exact Mass | 660.30 |
| IUPAC Name | [(E)-[2-ethyl-1-[4-[4-[(Z)-N-(piperidine-1-carbonyloxy)-C-(trifluoromethyl)carbonimidoyl]phenyl]sulfanylphenyl]hexylidene]amino] piperidine-1-carboxylate |
| SMILES | CCCCC(CC)/C(=N\OC(=O)N1CCCCC1)c1ccc(Sc2ccc(/C(=N/OC(=O)N3CCCCC3)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C34H43F3N4O4S/c1-3-5-12-25(4-2)30(38-44-32(42)40-21-8-6-9-22-40)26-13-17-28(18-14-26)46-29-19-15-27(16-20-29)31(34(35,36)37)39-45-33(43)41-23-10-7-11-24-41/h13-20,25H,3-12,21-24H2,1-2H3/b38-30+,39-31- |
| InChIKey | AMRLVWWPSUBRIA-KALMLEGPSA-N |
| XLogP | 9.27 |
| TPSA | 83.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.80 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|