C20H19N3O3 — CID 10360432
[(Z)-[cyano-(3-phenoxyphenyl)methylidene]amino] piperidine-1-carboxylate (PubChem CID 10360432) has the molecular formula C20H19N3O3 and a molecular weight of 349.39 g/mol. Its IUPAC name is [(Z)-[cyano-(3-phenoxyphenyl)methylidene]amino] piperidine-1-carboxylate.
| Compound Name | [(Z)-[cyano-(3-phenoxyphenyl)methylidene]amino] piperidine-1-carboxylate |
|---|---|
| PubChem CID | 10360432 |
| Molecular Formula | C20H19N3O3 |
| Molecular Weight | 349.39 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | [(Z)-[cyano-(3-phenoxyphenyl)methylidene]amino] piperidine-1-carboxylate |
| SMILES | N#C/C(=N\OC(=O)N1CCCCC1)c1cccc(Oc2ccccc2)c1 |
| InChI | InChI=1S/C20H19N3O3/c21-15-19(22-26-20(24)23-12-5-2-6-13-23)16-8-7-11-18(14-16)25-17-9-3-1-4-10-17/h1,3-4,7-11,14H,2,5-6,12-13H2/b22-19+ |
| InChIKey | GMFVKPSNXHILQO-ZBJSNUHESA-N |
| XLogP | 4.33 |
| TPSA | 74.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|