About diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc
diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc (PubChem CID 135125865) has the molecular formula C10H14NO5PSZn
and a molecular weight of 356.66 g/mol. Its IUPAC name is diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc.
Molecular Properties
| Compound Name | diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc |
| PubChem CID | 135125865 |
| Molecular Formula | C10H14NO5PSZn |
| Molecular Weight | 356.66 g/mol |
| Exact Mass | 354.96 |
| IUPAC Name | diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc |
| SMILES | CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])cc1.[Zn] |
| InChI | InChI=1S/C10H14NO5PS.Zn/c1-3-14-17(18,15-4-2)16-10-7-5-9(6-8-10)11(12)13;/h5-8H,3-4H2,1-2H3; |
| InChIKey | GJKSLNLCCZNRQD-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.66 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc?
The IUPAC name of diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc (CID 135125865) is diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc.
What is the SMILES notation for diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc?
The canonical SMILES for diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc is CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])cc1.[Zn].
What is the InChIKey of diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc?
The InChIKey is GJKSLNLCCZNRQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14NO5PS.Zn/c1-3-14-17(18,15-4-2)16-10-7-5-9(6-8-10)11(12)13;/h5-8H,3-4H2,1-2H3;.
What are the key properties of diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc?
diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc has a molecular weight of 356.66 g/mol, XLogP of 3.27, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;zinc is sourced from PubChem (CID 135125865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).