C16H29NO9P2S3 — CID 56842438
diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;1-dimethoxyphosphorylsulfanyl-2-ethylsulfinylethane (PubChem CID 56842438) has the molecular formula C16H29NO9P2S3 and a molecular weight of 537.56 g/mol. Its IUPAC name is diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;1-dimethoxyphosphorylsulfanyl-2-ethylsulfinylethane.
| Compound Name | diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;1-dimethoxyphosphorylsulfanyl-2-ethylsulfinylethane |
|---|---|
| PubChem CID | 56842438 |
| Molecular Formula | C16H29NO9P2S3 |
| Molecular Weight | 537.56 g/mol |
| Exact Mass | 537.05 |
| IUPAC Name | diethoxy-(4-nitrophenoxy)-sulfanylidene-λ5-phosphane;1-dimethoxyphosphorylsulfanyl-2-ethylsulfinylethane |
| SMILES | CCOP(=S)(OCC)Oc1ccc([N+](=O)[O-])cc1.CCS(=O)CCSP(=O)(OC)OC |
| InChI | InChI=1S/C10H14NO5PS.C6H15O4PS2/c1-3-14-17(18,15-4-2)16-10-7-5-9(6-8-10)11(12)13;1-4-13(8)6-5-12-11(7,9-2)10-3/h5-8H,3-4H2,1-2H3;4-6H2,1-3H3 |
| InChIKey | JDGKSBKLIRTROU-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 123.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.56 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|