C63H57O4P — CID 139911356
tris[4-(1,2-diphenylpropan-2-yl)phenyl] phosphate (PubChem CID 139911356) has the molecular formula C63H57O4P and a molecular weight of 909.12 g/mol. Its IUPAC name is tris[4-(1,2-diphenylpropan-2-yl)phenyl] phosphate.
| Compound Name | tris[4-(1,2-diphenylpropan-2-yl)phenyl] phosphate |
|---|---|
| PubChem CID | 139911356 |
| Molecular Formula | C63H57O4P |
| Molecular Weight | 909.12 g/mol |
| Exact Mass | 908.40 |
| IUPAC Name | tris[4-(1,2-diphenylpropan-2-yl)phenyl] phosphate |
| SMILES | CC(Cc1ccccc1)(c1ccccc1)c1ccc(OP(=O)(Oc2ccc(C(C)(Cc3ccccc3)c3ccccc3)cc2)Oc2ccc(C(C)(Cc3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C63H57O4P/c1-61(52-28-16-7-17-29-52,46-49-22-10-4-11-23-49)55-34-40-58(41-35-55)65-68(64,66-59-42-36-56(37-43-59)62(2,53-30-18-8-19-31-53)47-50-24-12-5-13-25-50)67-60-44-38-57(39-45-60)63(3,54-32-20-9-21-33-54)48-51-26-14-6-15-27-51/h4-45H,46-48H2,1-3H3 |
| InChIKey | ROHMGLVUXDYKCY-UHFFFAOYSA-N |
| XLogP | 15.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 909.12 |
| LogP ≤ 5 | 15.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|