C28H34NO5P — CID 53318676
benzyl N-[(1S)-1-bis(2,5-dimethylphenoxy)phosphoryl-2-methylpropyl]carbamate (PubChem CID 53318676) has the molecular formula C28H34NO5P and a molecular weight of 495.56 g/mol. Its IUPAC name is benzyl N-[(1S)-1-bis(2,5-dimethylphenoxy)phosphoryl-2-methylpropyl]carbamate.
| Compound Name | benzyl N-[(1S)-1-bis(2,5-dimethylphenoxy)phosphoryl-2-methylpropyl]carbamate |
|---|---|
| PubChem CID | 53318676 |
| Molecular Formula | C28H34NO5P |
| Molecular Weight | 495.56 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | benzyl N-[(1S)-1-bis(2,5-dimethylphenoxy)phosphoryl-2-methylpropyl]carbamate |
| SMILES | Cc1ccc(C)c(OP(=O)(Oc2cc(C)ccc2C)[C@H](NC(=O)OCc2ccccc2)C(C)C)c1 |
| InChI | InChI=1S/C28H34NO5P/c1-19(2)27(29-28(30)32-18-24-10-8-7-9-11-24)35(31,33-25-16-20(3)12-14-22(25)5)34-26-17-21(4)13-15-23(26)6/h7-17,19,27H,18H2,1-6H3,(H,29,30)/t27-/m0/s1 |
| InChIKey | AXZZKORXPNAMJG-MHZLTWQESA-N |
| XLogP | 7.48 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.56 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|