C19H20INO3 — CID 93036375
(2R)-2-[(3,5-dimethylphenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoic acid (PubChem CID 93036375) has the molecular formula C19H20INO3 and a molecular weight of 437.28 g/mol. Its IUPAC name is (2R)-2-[(3,5-dimethylphenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoic acid.
| Compound Name | (2R)-2-[(3,5-dimethylphenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 93036375 |
| Molecular Formula | C19H20INO3 |
| Molecular Weight | 437.28 g/mol |
| Exact Mass | 437.05 |
| IUPAC Name | (2R)-2-[(3,5-dimethylphenyl)methyl]-4-(2-iodoanilino)-4-oxobutanoic acid |
| SMILES | Cc1cc(C)cc(C[C@H](CC(=O)Nc2ccccc2I)C(=O)O)c1 |
| InChI | InChI=1S/C19H20INO3/c1-12-7-13(2)9-14(8-12)10-15(19(23)24)11-18(22)21-17-6-4-3-5-16(17)20/h3-9,15H,10-11H2,1-2H3,(H,21,22)(H,23,24)/t15-/m1/s1 |
| InChIKey | VOUBMZDBOLZHPH-OAHLLOKOSA-N |
| XLogP | 4.18 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.28 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|