C30H36NO5P — CID 166751515
(2S,3S)-2-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]-3-methylpentanoic acid (PubChem CID 166751515) has the molecular formula C30H36NO5P and a molecular weight of 521.59 g/mol. Its IUPAC name is (2S,3S)-2-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 166751515 |
| Molecular Formula | C30H36NO5P |
| Molecular Weight | 521.59 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | (2S,3S)-2-[[2-[[hydroxy(2-phenylethyl)phosphoryl]methyl]-3-(4-phenylphenyl)propanoyl]amino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)C(Cc1ccc(-c2ccccc2)cc1)CP(=O)(O)CCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C30H36NO5P/c1-3-22(2)28(30(33)34)31-29(32)27(21-37(35,36)19-18-23-10-6-4-7-11-23)20-24-14-16-26(17-15-24)25-12-8-5-9-13-25/h4-17,22,27-28H,3,18-21H2,1-2H3,(H,31,32)(H,33,34)(H,35,36)/t22-,27?,28-/m0/s1 |
| InChIKey | ISUWJPRPGNLVTI-XFFXTOGMSA-N |
| XLogP | 5.64 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.59 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|