C17H26NO5P — CID 70445902
(2S)-2-[[2-benzyl-3-[butyl(hydroxy)phosphoryl]propanoyl]amino]propanoic acid (PubChem CID 70445902) has the molecular formula C17H26NO5P and a molecular weight of 355.37 g/mol. Its IUPAC name is (2S)-2-[[2-benzyl-3-[butyl(hydroxy)phosphoryl]propanoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[2-benzyl-3-[butyl(hydroxy)phosphoryl]propanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 70445902 |
| Molecular Formula | C17H26NO5P |
| Molecular Weight | 355.37 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | (2S)-2-[[2-benzyl-3-[butyl(hydroxy)phosphoryl]propanoyl]amino]propanoic acid |
| SMILES | CCCCP(=O)(O)CC(Cc1ccccc1)C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C17H26NO5P/c1-3-4-10-24(22,23)12-15(11-14-8-6-5-7-9-14)16(19)18-13(2)17(20)21/h5-9,13,15H,3-4,10-12H2,1-2H3,(H,18,19)(H,20,21)(H,22,23)/t13-,15?/m0/s1 |
| InChIKey | HLHITGZGYPQYEX-CFMCSPIPSA-N |
| XLogP | 2.51 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|