C24H30ClN3O4 — CID 158122424
(2-chlorophenyl)methyl N-[(5S)-5,9-diamino-8-benzyl-6,9-dioxononyl]carbamate (PubChem CID 158122424) has the molecular formula C24H30ClN3O4 and a molecular weight of 459.97 g/mol. Its IUPAC name is (2-chlorophenyl)methyl N-[(5S)-5,9-diamino-8-benzyl-6,9-dioxononyl]carbamate.
| Compound Name | (2-chlorophenyl)methyl N-[(5S)-5,9-diamino-8-benzyl-6,9-dioxononyl]carbamate |
|---|---|
| PubChem CID | 158122424 |
| Molecular Formula | C24H30ClN3O4 |
| Molecular Weight | 459.97 g/mol |
| Exact Mass | 459.19 |
| IUPAC Name | (2-chlorophenyl)methyl N-[(5S)-5,9-diamino-8-benzyl-6,9-dioxononyl]carbamate |
| SMILES | NC(=O)C(CC(=O)[C@@H](N)CCCCNC(=O)OCc1ccccc1Cl)Cc1ccccc1 |
| InChI | InChI=1S/C24H30ClN3O4/c25-20-11-5-4-10-18(20)16-32-24(31)28-13-7-6-12-21(26)22(29)15-19(23(27)30)14-17-8-2-1-3-9-17/h1-5,8-11,19,21H,6-7,12-16,26H2,(H2,27,30)(H,28,31)/t19?,21-/m0/s1 |
| InChIKey | VZYRCRZFGJAULM-QWAKEFERSA-N |
| XLogP | 3.37 |
| TPSA | 124.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.97 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|