C32H42ClN3O7 — CID 157083608
4-[[5-(butylcarbamoyl)-9-[(2-chlorophenyl)methoxycarbonylamino]-3-oxo-1-phenylnonan-2-yl]amino]-4-oxobutanoic acid (PubChem CID 157083608) has the molecular formula C32H42ClN3O7 and a molecular weight of 616.16 g/mol. Its IUPAC name is 4-[[5-(butylcarbamoyl)-9-[(2-chlorophenyl)methoxycarbonylamino]-3-oxo-1-phenylnonan-2-yl]amino]-4-oxobutanoic acid.
| Compound Name | 4-[[5-(butylcarbamoyl)-9-[(2-chlorophenyl)methoxycarbonylamino]-3-oxo-1-phenylnonan-2-yl]amino]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 157083608 |
| Molecular Formula | C32H42ClN3O7 |
| Molecular Weight | 616.16 g/mol |
| Exact Mass | 615.27 |
| IUPAC Name | 4-[[5-(butylcarbamoyl)-9-[(2-chlorophenyl)methoxycarbonylamino]-3-oxo-1-phenylnonan-2-yl]amino]-4-oxobutanoic acid |
| SMILES | CCCCNC(=O)C(CCCCNC(=O)OCc1ccccc1Cl)CC(=O)C(Cc1ccccc1)NC(=O)CCC(=O)O |
| InChI | InChI=1S/C32H42ClN3O7/c1-2-3-18-34-31(41)24(13-9-10-19-35-32(42)43-22-25-14-7-8-15-26(25)33)21-28(37)27(20-23-11-5-4-6-12-23)36-29(38)16-17-30(39)40/h4-8,11-12,14-15,24,27H,2-3,9-10,13,16-22H2,1H3,(H,34,41)(H,35,42)(H,36,38)(H,39,40) |
| InChIKey | JMNZTSSOWQYOLL-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 616.16 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|