C43H49ClN4O8 — CID 10581107
benzyl 2-[4-[[(2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate (PubChem CID 10581107) has the molecular formula C43H49ClN4O8 and a molecular weight of 785.34 g/mol. Its IUPAC name is benzyl 2-[4-[[(2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate.
| Compound Name | benzyl 2-[4-[[(2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate |
|---|---|
| PubChem CID | 10581107 |
| Molecular Formula | C43H49ClN4O8 |
| Molecular Weight | 785.34 g/mol |
| Exact Mass | 784.32 |
| IUPAC Name | benzyl 2-[4-[[(2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-phenylpropanoyl]amino]phenyl]acetate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCc1ccccc1Cl)C(=O)N[C@@H](Cc1ccccc1)C(=O)Nc1ccc(CC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C43H49ClN4O8/c1-43(2,3)56-42(53)48-36(20-12-13-25-45-41(52)55-29-33-18-10-11-19-35(33)44)39(50)47-37(26-30-14-6-4-7-15-30)40(51)46-34-23-21-31(22-24-34)27-38(49)54-28-32-16-8-5-9-17-32/h4-11,14-19,21-24,36-37H,12-13,20,25-29H2,1-3H3,(H,45,52)(H,46,51)(H,47,50)(H,48,53)/t36-,37-/m0/s1 |
| InChIKey | TZWMFFRVNQXLOT-BCRBLDSWSA-N |
| XLogP | 7.28 |
| TPSA | 161.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.34 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|