C23H34ClN3O8 — CID 101039744
methyl (2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxypropanoate (PubChem CID 101039744) has the molecular formula C23H34ClN3O8 and a molecular weight of 515.99 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxypropanoate.
| Compound Name | methyl (2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxypropanoate |
|---|---|
| PubChem CID | 101039744 |
| Molecular Formula | C23H34ClN3O8 |
| Molecular Weight | 515.99 g/mol |
| Exact Mass | 515.20 |
| IUPAC Name | methyl (2S)-2-[[(2S)-6-[(2-chlorophenyl)methoxycarbonylamino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoyl]amino]-3-hydroxypropanoate |
| SMILES | COC(=O)[C@H](CO)NC(=O)[C@H](CCCCNC(=O)OCc1ccccc1Cl)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H34ClN3O8/c1-23(2,3)35-22(32)27-17(19(29)26-18(13-28)20(30)33-4)11-7-8-12-25-21(31)34-14-15-9-5-6-10-16(15)24/h5-6,9-10,17-18,28H,7-8,11-14H2,1-4H3,(H,25,31)(H,26,29)(H,27,32)/t17-,18-/m0/s1 |
| InChIKey | MNTQVBCSMQJVAQ-ROUUACIJSA-N |
| XLogP | 2.28 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.99 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|