C7H14N4O4 — CID 101417077
(2S)-2-amino-5-(carbamoylcarbamoylamino)pentanoic acid (PubChem CID 101417077) has the molecular formula C7H14N4O4 and a molecular weight of 218.21 g/mol. Its IUPAC name is (2S)-2-amino-5-(carbamoylcarbamoylamino)pentanoic acid.
| Compound Name | (2S)-2-amino-5-(carbamoylcarbamoylamino)pentanoic acid |
|---|---|
| PubChem CID | 101417077 |
| Molecular Formula | C7H14N4O4 |
| Molecular Weight | 218.21 g/mol |
| Exact Mass | 218.10 |
| IUPAC Name | (2S)-2-amino-5-(carbamoylcarbamoylamino)pentanoic acid |
| SMILES | NC(=O)NC(=O)NCCC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H14N4O4/c8-4(5(12)13)2-1-3-10-7(15)11-6(9)14/h4H,1-3,8H2,(H,12,13)(H4,9,10,11,14,15)/t4-/m0/s1 |
| InChIKey | RBCZRWHHVQLICK-BYPYZUCNSA-N |
| XLogP | -1.44 |
| TPSA | 147.54 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.21 |
| LogP ≤ 5 | -1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|