C17H25F3N2O3 — CID 142350928
N-butyl-2,2,2-trifluoroacetamide;2-(3-phenylpropylamino)acetic acid (PubChem CID 142350928) has the molecular formula C17H25F3N2O3 and a molecular weight of 362.39 g/mol. Its IUPAC name is N-butyl-2,2,2-trifluoroacetamide;2-(3-phenylpropylamino)acetic acid.
| Compound Name | N-butyl-2,2,2-trifluoroacetamide;2-(3-phenylpropylamino)acetic acid |
|---|---|
| PubChem CID | 142350928 |
| Molecular Formula | C17H25F3N2O3 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | N-butyl-2,2,2-trifluoroacetamide;2-(3-phenylpropylamino)acetic acid |
| SMILES | CCCCNC(=O)C(F)(F)F.O=C(O)CNCCCc1ccccc1 |
| InChI | InChI=1S/C11H15NO2.C6H10F3NO/c13-11(14)9-12-8-4-7-10-5-2-1-3-6-10;1-2-3-4-10-5(11)6(7,8)9/h1-3,5-6,12H,4,7-9H2,(H,13,14);2-4H2,1H3,(H,10,11) |
| InChIKey | KPDOIQTXEXCZCL-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|