C15H24N2O3S — CID 112994808
2-(butylsulfonylamino)-N-(3-phenylpropyl)acetamide (PubChem CID 112994808) has the molecular formula C15H24N2O3S and a molecular weight of 312.43 g/mol. Its IUPAC name is 2-(butylsulfonylamino)-N-(3-phenylpropyl)acetamide.
| Compound Name | 2-(butylsulfonylamino)-N-(3-phenylpropyl)acetamide |
|---|---|
| PubChem CID | 112994808 |
| Molecular Formula | C15H24N2O3S |
| Molecular Weight | 312.43 g/mol |
| Exact Mass | 312.15 |
| IUPAC Name | 2-(butylsulfonylamino)-N-(3-phenylpropyl)acetamide |
| SMILES | CCCCS(=O)(=O)NCC(=O)NCCCc1ccccc1 |
| InChI | InChI=1S/C15H24N2O3S/c1-2-3-12-21(19,20)17-13-15(18)16-11-7-10-14-8-5-4-6-9-14/h4-6,8-9,17H,2-3,7,10-13H2,1H3,(H,16,18) |
| InChIKey | PFHFEQHBVQACJQ-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|