C30H62N4O6S2 — CID 20789852
2-(octylsulfonylamino)-N-[10-[[2-(octylsulfonylamino)acetyl]amino]decyl]acetamide (PubChem CID 20789852) has the molecular formula C30H62N4O6S2 and a molecular weight of 638.98 g/mol. Its IUPAC name is 2-(octylsulfonylamino)-N-[10-[[2-(octylsulfonylamino)acetyl]amino]decyl]acetamide.
| Compound Name | 2-(octylsulfonylamino)-N-[10-[[2-(octylsulfonylamino)acetyl]amino]decyl]acetamide |
|---|---|
| PubChem CID | 20789852 |
| Molecular Formula | C30H62N4O6S2 |
| Molecular Weight | 638.98 g/mol |
| Exact Mass | 638.41 |
| IUPAC Name | 2-(octylsulfonylamino)-N-[10-[[2-(octylsulfonylamino)acetyl]amino]decyl]acetamide |
| SMILES | CCCCCCCCS(=O)(=O)NCC(=O)NCCCCCCCCCCNC(=O)CNS(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C30H62N4O6S2/c1-3-5-7-9-17-21-25-41(37,38)33-27-29(35)31-23-19-15-13-11-12-14-16-20-24-32-30(36)28-34-42(39,40)26-22-18-10-8-6-4-2/h33-34H,3-28H2,1-2H3,(H,31,35)(H,32,36) |
| InChIKey | CSHGRKIEKOVJCY-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 150.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 638.98 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|