C10H9N3OS — CID 63038083
N-(pyridin-2-ylmethyl)-1,3-thiazole-4-carboxamide (PubChem CID 63038083) has the molecular formula C10H9N3OS and a molecular weight of 219.27 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-1,3-thiazole-4-carboxamide.
| Compound Name | N-(pyridin-2-ylmethyl)-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 63038083 |
| Molecular Formula | C10H9N3OS |
| Molecular Weight | 219.27 g/mol |
| Exact Mass | 219.05 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cscn1 |
| InChI | InChI=1S/C10H9N3OS/c14-10(9-6-15-7-13-9)12-5-8-3-1-2-4-11-8/h1-4,6-7H,5H2,(H,12,14) |
| InChIKey | YOCXCMXZYVERJM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |