C15H18N2OS — CID 110471823
N-[(4-tert-butylphenyl)methyl]-1,3-thiazole-4-carboxamide (PubChem CID 110471823) has the molecular formula C15H18N2OS and a molecular weight of 274.39 g/mol. Its IUPAC name is N-[(4-tert-butylphenyl)methyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[(4-tert-butylphenyl)methyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 110471823 |
| Molecular Formula | C15H18N2OS |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | N-[(4-tert-butylphenyl)methyl]-1,3-thiazole-4-carboxamide |
| SMILES | CC(C)(C)c1ccc(CNC(=O)c2cscn2)cc1 |
| InChI | InChI=1S/C15H18N2OS/c1-15(2,3)12-6-4-11(5-7-12)8-16-14(18)13-9-19-10-17-13/h4-7,9-10H,8H2,1-3H3,(H,16,18) |
| InChIKey | ROVYXEHLDOUDOJ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |