C17H16N6O — CID 109282922
N-(pyridin-2-ylmethyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide (PubChem CID 109282922) has the molecular formula C17H16N6O and a molecular weight of 320.36 g/mol. Its IUPAC name is N-(pyridin-2-ylmethyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide.
| Compound Name | N-(pyridin-2-ylmethyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109282922 |
| Molecular Formula | C17H16N6O |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | N-(pyridin-2-ylmethyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide |
| SMILES | O=C(NCc1ccccn1)c1cnc(NCc2ccccn2)cn1 |
| InChI | InChI=1S/C17H16N6O/c24-17(23-10-14-6-2-4-8-19-14)15-11-22-16(12-20-15)21-9-13-5-1-3-7-18-13/h1-8,11-12H,9-10H2,(H,21,22)(H,23,24) |
| InChIKey | KCXVPSJMULLEMF-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 92.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |