C21H23N5O — CID 109283133
N-(4-tert-butylphenyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide (PubChem CID 109283133) has the molecular formula C21H23N5O and a molecular weight of 361.45 g/mol. Its IUPAC name is N-(4-tert-butylphenyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide.
| Compound Name | N-(4-tert-butylphenyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 109283133 |
| Molecular Formula | C21H23N5O |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | N-(4-tert-butylphenyl)-5-(pyridin-2-ylmethylamino)pyrazine-2-carboxamide |
| SMILES | CC(C)(C)c1ccc(NC(=O)c2cnc(NCc3ccccn3)cn2)cc1 |
| InChI | InChI=1S/C21H23N5O/c1-21(2,3)15-7-9-16(10-8-15)26-20(27)18-13-25-19(14-23-18)24-12-17-6-4-5-11-22-17/h4-11,13-14H,12H2,1-3H3,(H,24,25)(H,26,27) |
| InChIKey | VJSUYPUNKQECHO-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |