C19H17N5O3 — CID 109283169
methyl 4-[[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate (PubChem CID 109283169) has the molecular formula C19H17N5O3 and a molecular weight of 363.38 g/mol. Its IUPAC name is methyl 4-[[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109283169 |
| Molecular Formula | C19H17N5O3 |
| Molecular Weight | 363.38 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | methyl 4-[[5-(pyridin-2-ylmethylamino)pyrazine-2-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cnc(NCc3ccccn3)cn2)cc1 |
| InChI | InChI=1S/C19H17N5O3/c1-27-19(26)13-5-7-14(8-6-13)24-18(25)16-11-23-17(12-21-16)22-10-15-4-2-3-9-20-15/h2-9,11-12H,10H2,1H3,(H,22,23)(H,24,25) |
| InChIKey | CPFCPBIWHSJGKH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 106.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.38 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |