C16H15N5O2S — CID 117083558
N-(2-phenoxyethyl)-2-(pyrimidin-4-ylamino)-1,3-thiazole-5-carboxamide (PubChem CID 117083558) has the molecular formula C16H15N5O2S and a molecular weight of 341.40 g/mol. Its IUPAC name is N-(2-phenoxyethyl)-2-(pyrimidin-4-ylamino)-1,3-thiazole-5-carboxamide.
| Compound Name | N-(2-phenoxyethyl)-2-(pyrimidin-4-ylamino)-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 117083558 |
| Molecular Formula | C16H15N5O2S |
| Molecular Weight | 341.40 g/mol |
| Exact Mass | 341.09 |
| IUPAC Name | N-(2-phenoxyethyl)-2-(pyrimidin-4-ylamino)-1,3-thiazole-5-carboxamide |
| SMILES | O=C(NCCOc1ccccc1)c1cnc(Nc2ccncn2)s1 |
| InChI | InChI=1S/C16H15N5O2S/c22-15(18-8-9-23-12-4-2-1-3-5-12)13-10-19-16(24-13)21-14-6-7-17-11-20-14/h1-7,10-11H,8-9H2,(H,18,22)(H,17,19,20,21) |
| InChIKey | RHEXCGYZNBGYED-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|