C8H11N3O2S — CID 130637977
2-(cyclopropylamino)-N-methoxy-1,3-thiazole-5-carboxamide (PubChem CID 130637977) has the molecular formula C8H11N3O2S and a molecular weight of 213.26 g/mol. Its IUPAC name is 2-(cyclopropylamino)-N-methoxy-1,3-thiazole-5-carboxamide.
| Compound Name | 2-(cyclopropylamino)-N-methoxy-1,3-thiazole-5-carboxamide |
|---|---|
| PubChem CID | 130637977 |
| Molecular Formula | C8H11N3O2S |
| Molecular Weight | 213.26 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | 2-(cyclopropylamino)-N-methoxy-1,3-thiazole-5-carboxamide |
| SMILES | CONC(=O)c1cnc(NC2CC2)s1 |
| InChI | InChI=1S/C8H11N3O2S/c1-13-11-7(12)6-4-9-8(14-6)10-5-2-3-5/h4-5H,2-3H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | LHXXJRWACROYOI-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|