C20H15N3O4S — CID 59735921
ethyl 2-[[3-(2-cyanophenoxy)benzoyl]amino]-1,3-thiazole-5-carboxylate (PubChem CID 59735921) has the molecular formula C20H15N3O4S and a molecular weight of 393.42 g/mol. Its IUPAC name is ethyl 2-[[3-(2-cyanophenoxy)benzoyl]amino]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[[3-(2-cyanophenoxy)benzoyl]amino]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 59735921 |
| Molecular Formula | C20H15N3O4S |
| Molecular Weight | 393.42 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | ethyl 2-[[3-(2-cyanophenoxy)benzoyl]amino]-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NC(=O)c2cccc(Oc3ccccc3C#N)c2)s1 |
| InChI | InChI=1S/C20H15N3O4S/c1-2-26-19(25)17-12-22-20(28-17)23-18(24)13-7-5-8-15(10-13)27-16-9-4-3-6-14(16)11-21/h3-10,12H,2H2,1H3,(H,22,23,24) |
| InChIKey | YSBVFQDDJXVTKZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 101.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.42 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |