C15H11Cl2N5O2 — CID 17027340
5-(3,4-dichlorophenyl)-N-(2-prop-2-enyltetrazol-5-yl)furan-2-carboxamide (PubChem CID 17027340) has the molecular formula C15H11Cl2N5O2 and a molecular weight of 364.19 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-(2-prop-2-enyltetrazol-5-yl)furan-2-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-(2-prop-2-enyltetrazol-5-yl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17027340 |
| Molecular Formula | C15H11Cl2N5O2 |
| Molecular Weight | 364.19 g/mol |
| Exact Mass | 363.03 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-(2-prop-2-enyltetrazol-5-yl)furan-2-carboxamide |
| SMILES | C=CCn1nnc(NC(=O)c2ccc(-c3ccc(Cl)c(Cl)c3)o2)n1 |
| InChI | InChI=1S/C15H11Cl2N5O2/c1-2-7-22-20-15(19-21-22)18-14(23)13-6-5-12(24-13)9-3-4-10(16)11(17)8-9/h2-6,8H,1,7H2,(H,18,20,23) |
| InChIKey | QMHWPJSTRGARKN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|