C20H17Cl2NO2 — CID 23880214
5-(3,4-dichlorophenyl)-N-(2-propan-2-ylphenyl)furan-2-carboxamide (PubChem CID 23880214) has the molecular formula C20H17Cl2NO2 and a molecular weight of 374.27 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-(2-propan-2-ylphenyl)furan-2-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-(2-propan-2-ylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 23880214 |
| Molecular Formula | C20H17Cl2NO2 |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-(2-propan-2-ylphenyl)furan-2-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C20H17Cl2NO2/c1-12(2)14-5-3-4-6-17(14)23-20(24)19-10-9-18(25-19)13-7-8-15(21)16(22)11-13/h3-12H,1-2H3,(H,23,24) |
| InChIKey | SNTSJBFWAITPIQ-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |