C19H14Cl2INO2 — CID 17117529
5-(3,4-dichlorophenyl)-N-(2-ethyl-4-iodophenyl)furan-2-carboxamide (PubChem CID 17117529) has the molecular formula C19H14Cl2INO2 and a molecular weight of 486.14 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-N-(2-ethyl-4-iodophenyl)furan-2-carboxamide.
| Compound Name | 5-(3,4-dichlorophenyl)-N-(2-ethyl-4-iodophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 17117529 |
| Molecular Formula | C19H14Cl2INO2 |
| Molecular Weight | 486.14 g/mol |
| Exact Mass | 484.94 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-N-(2-ethyl-4-iodophenyl)furan-2-carboxamide |
| SMILES | CCc1cc(I)ccc1NC(=O)c1ccc(-c2ccc(Cl)c(Cl)c2)o1 |
| InChI | InChI=1S/C19H14Cl2INO2/c1-2-11-9-13(22)4-6-16(11)23-19(24)18-8-7-17(25-18)12-3-5-14(20)15(21)10-12/h3-10H,2H2,1H3,(H,23,24) |
| InChIKey | RNNKOIMWWHISLC-UHFFFAOYSA-N |
| XLogP | 6.67 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.14 |
| LogP ≤ 5 | 6.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|