C15H12Cl2INO — CID 5014387
3,4-dichloro-N-(2-ethyl-4-iodophenyl)benzamide (PubChem CID 5014387) has the molecular formula C15H12Cl2INO and a molecular weight of 420.08 g/mol. Its IUPAC name is 3,4-dichloro-N-(2-ethyl-4-iodophenyl)benzamide.
| Compound Name | 3,4-dichloro-N-(2-ethyl-4-iodophenyl)benzamide |
|---|---|
| PubChem CID | 5014387 |
| Molecular Formula | C15H12Cl2INO |
| Molecular Weight | 420.08 g/mol |
| Exact Mass | 418.93 |
| IUPAC Name | 3,4-dichloro-N-(2-ethyl-4-iodophenyl)benzamide |
| SMILES | CCc1cc(I)ccc1NC(=O)c1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C15H12Cl2INO/c1-2-9-7-11(18)4-6-14(9)19-15(20)10-3-5-12(16)13(17)8-10/h3-8H,2H2,1H3,(H,19,20) |
| InChIKey | LNQQFMNHZRJQGB-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.08 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|