C12H14INO — CID 171064344
N-(2-ethyl-4-iodophenyl)cyclopropanecarboxamide (PubChem CID 171064344) has the molecular formula C12H14INO and a molecular weight of 315.15 g/mol. Its IUPAC name is N-(2-ethyl-4-iodophenyl)cyclopropanecarboxamide.
| Compound Name | N-(2-ethyl-4-iodophenyl)cyclopropanecarboxamide |
|---|---|
| PubChem CID | 171064344 |
| Molecular Formula | C12H14INO |
| Molecular Weight | 315.15 g/mol |
| Exact Mass | 315.01 |
| IUPAC Name | N-(2-ethyl-4-iodophenyl)cyclopropanecarboxamide |
| SMILES | CCc1cc(I)ccc1NC(=O)C1CC1 |
| InChI | InChI=1S/C12H14INO/c1-2-8-7-10(13)5-6-11(8)14-12(15)9-3-4-9/h5-7,9H,2-4H2,1H3,(H,14,15) |
| InChIKey | GFPDQCRDKLSMLY-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.15 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|