C20H18INO2 — CID 4309569
5-(3,4-dimethylphenyl)-N-(4-iodo-2-methylphenyl)furan-2-carboxamide (PubChem CID 4309569) has the molecular formula C20H18INO2 and a molecular weight of 431.27 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-(4-iodo-2-methylphenyl)furan-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-(4-iodo-2-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4309569 |
| Molecular Formula | C20H18INO2 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 431.04 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-(4-iodo-2-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)Nc3ccc(I)cc3C)o2)cc1C |
| InChI | InChI=1S/C20H18INO2/c1-12-4-5-15(10-13(12)2)18-8-9-19(24-18)20(23)22-17-7-6-16(21)11-14(17)3/h4-11H,1-3H3,(H,22,23) |
| InChIKey | YJTPPWQZTPYPNJ-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|