C19H15ClINO2 — CID 3580369
N-(2-chloro-4-iodophenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide (PubChem CID 3580369) has the molecular formula C19H15ClINO2 and a molecular weight of 451.69 g/mol. Its IUPAC name is N-(2-chloro-4-iodophenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide.
| Compound Name | N-(2-chloro-4-iodophenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3580369 |
| Molecular Formula | C19H15ClINO2 |
| Molecular Weight | 451.69 g/mol |
| Exact Mass | 450.98 |
| IUPAC Name | N-(2-chloro-4-iodophenyl)-5-(3,4-dimethylphenyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)Nc3ccc(I)cc3Cl)o2)cc1C |
| InChI | InChI=1S/C19H15ClINO2/c1-11-3-4-13(9-12(11)2)17-7-8-18(24-17)19(23)22-16-6-5-14(21)10-15(16)20/h3-10H,1-2H3,(H,22,23) |
| InChIKey | PJRGBQYWFWCEMG-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.69 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|