C15H17NO3 — CID 82121160
5-(3,4-dimethylphenyl)-N-(2-hydroxyethyl)furan-2-carboxamide (PubChem CID 82121160) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 5-(3,4-dimethylphenyl)-N-(2-hydroxyethyl)furan-2-carboxamide.
| Compound Name | 5-(3,4-dimethylphenyl)-N-(2-hydroxyethyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 82121160 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 5-(3,4-dimethylphenyl)-N-(2-hydroxyethyl)furan-2-carboxamide |
| SMILES | Cc1ccc(-c2ccc(C(=O)NCCO)o2)cc1C |
| InChI | InChI=1S/C15H17NO3/c1-10-3-4-12(9-11(10)2)13-5-6-14(19-13)15(18)16-7-8-17/h3-6,9,17H,7-8H2,1-2H3,(H,16,18) |
| InChIKey | AJVAUPFFWXUMSM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |